C25H38N6O2S — CID 143450356
1-(2,4-dimethylphenyl)-3-[6-(dipropylamino)-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]thiourea (PubChem CID 143450356) has the molecular formula C25H38N6O2S and a molecular weight of 486.69 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[6-(dipropylamino)-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]thiourea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[6-(dipropylamino)-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]thiourea |
|---|---|
| PubChem CID | 143450356 |
| Molecular Formula | C25H38N6O2S |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[6-(dipropylamino)-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]thiourea |
| SMILES | CCCN(CCC)c1cc(NC(=S)Nc2ccc(C)cc2C)nc(OCCN2CCOCC2)n1 |
| InChI | InChI=1S/C25H38N6O2S/c1-5-9-31(10-6-2)23-18-22(28-25(34)26-21-8-7-19(3)17-20(21)4)27-24(29-23)33-16-13-30-11-14-32-15-12-30/h7-8,17-18H,5-6,9-16H2,1-4H3,(H2,26,27,28,29,34) |
| InChIKey | YZXHDPADLXUDGY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|