C27H42N6O3 — CID 143341593
(1E)-1-[[6-(dipropylamino)-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-2,3-dihydroinden-4-ol;ethane (PubChem CID 143341593) has the molecular formula C27H42N6O3 and a molecular weight of 498.67 g/mol. Its IUPAC name is (1E)-1-[[6-(dipropylamino)-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-2,3-dihydroinden-4-ol;ethane.
| Compound Name | (1E)-1-[[6-(dipropylamino)-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-2,3-dihydroinden-4-ol;ethane |
|---|---|
| PubChem CID | 143341593 |
| Molecular Formula | C27H42N6O3 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | (1E)-1-[[6-(dipropylamino)-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-2,3-dihydroinden-4-ol;ethane |
| SMILES | CC.CCCN(CCC)c1cc(N/N=C2\CCc3c(O)cccc32)nc(OCCN2CCOCC2)n1 |
| InChI | InChI=1S/C25H36N6O3.C2H6/c1-3-10-31(11-4-2)24-18-23(26-25(27-24)34-17-14-30-12-15-33-16-13-30)29-28-21-9-8-20-19(21)6-5-7-22(20)32;1-2/h5-7,18,32H,3-4,8-17H2,1-2H3,(H,26,27,29);1-2H3/b28-21+; |
| InChIKey | OQJBJGMKBIGFFI-HUPDFLJJSA-N |
| XLogP | 4.31 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|