C24H36N6O3 — CID 71193788
6-(dipropylamino)-N'-(3-methylphenyl)-2-(2-morpholin-4-ylethoxy)pyrimidine-4-carbohydrazide (PubChem CID 71193788) has the molecular formula C24H36N6O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is 6-(dipropylamino)-N'-(3-methylphenyl)-2-(2-morpholin-4-ylethoxy)pyrimidine-4-carbohydrazide.
| Compound Name | 6-(dipropylamino)-N'-(3-methylphenyl)-2-(2-morpholin-4-ylethoxy)pyrimidine-4-carbohydrazide |
|---|---|
| PubChem CID | 71193788 |
| Molecular Formula | C24H36N6O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 6-(dipropylamino)-N'-(3-methylphenyl)-2-(2-morpholin-4-ylethoxy)pyrimidine-4-carbohydrazide |
| SMILES | CCCN(CCC)c1cc(C(=O)NNc2cccc(C)c2)nc(OCCN2CCOCC2)n1 |
| InChI | InChI=1S/C24H36N6O3/c1-4-9-30(10-5-2)22-18-21(23(31)28-27-20-8-6-7-19(3)17-20)25-24(26-22)33-16-13-29-11-14-32-15-12-29/h6-8,17-18,27H,4-5,9-16H2,1-3H3,(H,28,31) |
| InChIKey | HEQFBCXXJZTLIL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|