C32H54N6O2 — CID 143340754
6-N-[(E)-(5,7-dimethyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine;ethane (PubChem CID 143340754) has the molecular formula C32H54N6O2 and a molecular weight of 554.82 g/mol. Its IUPAC name is 6-N-[(E)-(5,7-dimethyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine;ethane.
| Compound Name | 6-N-[(E)-(5,7-dimethyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine;ethane |
|---|---|
| PubChem CID | 143340754 |
| Molecular Formula | C32H54N6O2 |
| Molecular Weight | 554.82 g/mol |
| Exact Mass | 554.43 |
| IUPAC Name | 6-N-[(E)-(5,7-dimethyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine;ethane |
| SMILES | CC.CC.CCCN(CCC)c1cc(N/N=C2\CCCc3c(C)cc(C)cc32)nc(OCCN2CCOCC2)n1 |
| InChI | InChI=1S/C28H42N6O2.2C2H6/c1-5-10-34(11-6-2)27-20-26(29-28(30-27)36-17-14-33-12-15-35-16-13-33)32-31-25-9-7-8-23-22(4)18-21(3)19-24(23)25;2*1-2/h18-20H,5-17H2,1-4H3,(H,29,30,32);2*1-2H3/b31-25+;; |
| InChIKey | SHQSUBAZTGLHIV-ARXDYCJMSA-N |
| XLogP | 6.64 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.82 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|