C25H34N6O3 — CID 143450308
N-[(E)-(6-methyl-2,3-dihydrochromen-4-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-6-piperidin-1-ylpyrimidin-4-amine (PubChem CID 143450308) has the molecular formula C25H34N6O3 and a molecular weight of 466.59 g/mol. Its IUPAC name is N-[(E)-(6-methyl-2,3-dihydrochromen-4-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-6-piperidin-1-ylpyrimidin-4-amine.
| Compound Name | N-[(E)-(6-methyl-2,3-dihydrochromen-4-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-6-piperidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 143450308 |
| Molecular Formula | C25H34N6O3 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | N-[(E)-(6-methyl-2,3-dihydrochromen-4-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-6-piperidin-1-ylpyrimidin-4-amine |
| SMILES | Cc1ccc2c(c1)/C(=N/Nc1cc(N3CCCCC3)nc(OCCN3CCOCC3)n1)CCO2 |
| InChI | InChI=1S/C25H34N6O3/c1-19-5-6-22-20(17-19)21(7-13-33-22)28-29-23-18-24(31-8-3-2-4-9-31)27-25(26-23)34-16-12-30-10-14-32-15-11-30/h5-6,17-18H,2-4,7-16H2,1H3,(H,26,27,29)/b28-21+ |
| InChIKey | OMFHGLVSNLZREI-SGWCAAJKSA-N |
| XLogP | 3.09 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|