C23H30N6O4 — CID 91071322
1-(2H-chromen-4-yl)-2-[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazine (PubChem CID 91071322) has the molecular formula C23H30N6O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 1-(2H-chromen-4-yl)-2-[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazine.
| Compound Name | 1-(2H-chromen-4-yl)-2-[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 91071322 |
| Molecular Formula | C23H30N6O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 1-(2H-chromen-4-yl)-2-[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazine |
| SMILES | C1=C(NNc2cc(N3CCOCC3)nc(OCCN3CCOCC3)n2)c2ccccc2OC1 |
| InChI | InChI=1S/C23H30N6O4/c1-2-4-20-18(3-1)19(5-11-32-20)26-27-21-17-22(29-9-14-31-15-10-29)25-23(24-21)33-16-8-28-6-12-30-13-7-28/h1-5,17,26H,6-16H2,(H,24,25,27) |
| InChIKey | FYSDCUBSAHACCX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|