C24H32N6O4 — CID 58085757
(5E)-5-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-7,8-dihydro-6H-naphthalen-1-ol (PubChem CID 58085757) has the molecular formula C24H32N6O4 and a molecular weight of 468.56 g/mol. Its IUPAC name is (5E)-5-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-7,8-dihydro-6H-naphthalen-1-ol.
| Compound Name | (5E)-5-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-7,8-dihydro-6H-naphthalen-1-ol |
|---|---|
| PubChem CID | 58085757 |
| Molecular Formula | C24H32N6O4 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | (5E)-5-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-7,8-dihydro-6H-naphthalen-1-ol |
| SMILES | Oc1cccc2c1CCC/C2=N\Nc1cc(N2CCOCC2)nc(OCCN2CCOCC2)n1 |
| InChI | InChI=1S/C24H32N6O4/c31-21-6-2-3-18-19(21)4-1-5-20(18)27-28-22-17-23(30-10-14-33-15-11-30)26-24(25-22)34-16-9-29-7-12-32-13-8-29/h2-3,6,17,31H,1,4-5,7-16H2,(H,25,26,28)/b27-20+ |
| InChIKey | PPRLBVQXNLBOEO-NHFJDJAPSA-N |
| XLogP | 1.88 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|