C24H32N6O4 — CID 58085758
N-[(E)-(6-methoxy-2,3-dihydroinden-1-ylidene)amino]-6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-amine (PubChem CID 58085758) has the molecular formula C24H32N6O4 and a molecular weight of 468.56 g/mol. Its IUPAC name is N-[(E)-(6-methoxy-2,3-dihydroinden-1-ylidene)amino]-6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-amine.
| Compound Name | N-[(E)-(6-methoxy-2,3-dihydroinden-1-ylidene)amino]-6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 58085758 |
| Molecular Formula | C24H32N6O4 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | N-[(E)-(6-methoxy-2,3-dihydroinden-1-ylidene)amino]-6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-amine |
| SMILES | COc1ccc2c(c1)/C(=N/Nc1cc(N3CCOCC3)nc(OCCN3CCOCC3)n1)CC2 |
| InChI | InChI=1S/C24H32N6O4/c1-31-19-4-2-18-3-5-21(20(18)16-19)27-28-22-17-23(30-9-13-33-14-10-30)26-24(25-22)34-15-8-29-6-11-32-12-7-29/h2,4,16-17H,3,5-15H2,1H3,(H,25,26,28)/b27-21+ |
| InChIKey | NNQZDYXWRUIJCG-SZXQPVLSSA-N |
| XLogP | 1.80 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|