C28H50N6O2 — CID 143341665
ethane;2-(2-morpholin-4-ylethoxy)-N-[(E)-[(2S)-2-pentylcyclohexylidene]amino]-6-piperidin-1-ylpyrimidin-4-amine (PubChem CID 143341665) has the molecular formula C28H50N6O2 and a molecular weight of 502.75 g/mol. Its IUPAC name is ethane;2-(2-morpholin-4-ylethoxy)-N-[(E)-[(2S)-2-pentylcyclohexylidene]amino]-6-piperidin-1-ylpyrimidin-4-amine.
| Compound Name | ethane;2-(2-morpholin-4-ylethoxy)-N-[(E)-[(2S)-2-pentylcyclohexylidene]amino]-6-piperidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 143341665 |
| Molecular Formula | C28H50N6O2 |
| Molecular Weight | 502.75 g/mol |
| Exact Mass | 502.40 |
| IUPAC Name | ethane;2-(2-morpholin-4-ylethoxy)-N-[(E)-[(2S)-2-pentylcyclohexylidene]amino]-6-piperidin-1-ylpyrimidin-4-amine |
| SMILES | CC.CCCCC[C@H]1CCCC/C1=N\Nc1cc(N2CCCCC2)nc(OCCN2CCOCC2)n1 |
| InChI | InChI=1S/C26H44N6O2.C2H6/c1-2-3-5-10-22-11-6-7-12-23(22)29-30-24-21-25(32-13-8-4-9-14-32)28-26(27-24)34-20-17-31-15-18-33-19-16-31;1-2/h21-22H,2-20H2,1H3,(H,27,28,30);1-2H3/b29-23+;/t22-;/m0./s1 |
| InChIKey | WNZMELLINPWFCM-JZLDXZRGSA-N |
| XLogP | 5.74 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.75 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|