C19H24Cl2N4O2 — CID 68856599
2-butoxy-N-[(3,4-dichlorophenyl)methyl]-6-morpholin-4-ylpyrimidin-4-amine (PubChem CID 68856599) has the molecular formula C19H24Cl2N4O2 and a molecular weight of 411.33 g/mol. Its IUPAC name is 2-butoxy-N-[(3,4-dichlorophenyl)methyl]-6-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | 2-butoxy-N-[(3,4-dichlorophenyl)methyl]-6-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 68856599 |
| Molecular Formula | C19H24Cl2N4O2 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-butoxy-N-[(3,4-dichlorophenyl)methyl]-6-morpholin-4-ylpyrimidin-4-amine |
| SMILES | CCCCOc1nc(NCc2ccc(Cl)c(Cl)c2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H24Cl2N4O2/c1-2-3-8-27-19-23-17(12-18(24-19)25-6-9-26-10-7-25)22-13-14-4-5-15(20)16(21)11-14/h4-5,11-12H,2-3,6-10,13H2,1H3,(H,22,23,24) |
| InChIKey | SMXHFAYYKQGKKB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|