C16H17F3N4O2 — CID 122282584
6-morpholin-4-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]pyrimidin-4-amine (PubChem CID 122282584) has the molecular formula C16H17F3N4O2 and a molecular weight of 354.33 g/mol. Its IUPAC name is 6-morpholin-4-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]pyrimidin-4-amine.
| Compound Name | 6-morpholin-4-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 122282584 |
| Molecular Formula | C16H17F3N4O2 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 6-morpholin-4-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]pyrimidin-4-amine |
| SMILES | FC(F)(F)Oc1ccc(CNc2cc(N3CCOCC3)ncn2)cc1 |
| InChI | InChI=1S/C16H17F3N4O2/c17-16(18,19)25-13-3-1-12(2-4-13)10-20-14-9-15(22-11-21-14)23-5-7-24-8-6-23/h1-4,9,11H,5-8,10H2,(H,20,21,22) |
| InChIKey | HEARIBIIYNOZPF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |