C18H20F3N5O3 — CID 122327974
N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-4-(trifluoromethoxy)benzamide (PubChem CID 122327974) has the molecular formula C18H20F3N5O3 and a molecular weight of 411.38 g/mol. Its IUPAC name is N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 122327974 |
| Molecular Formula | C18H20F3N5O3 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(NCCNc1cc(N2CCOCC2)ncn1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H20F3N5O3/c19-18(20,21)29-14-3-1-13(2-4-14)17(27)23-6-5-22-15-11-16(25-12-24-15)26-7-9-28-10-8-26/h1-4,11-12H,5-10H2,(H,23,27)(H,22,24,25) |
| InChIKey | XKXIPFNPQLMFFY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|