C18H23N5O2S — CID 122328012
4-methylsulfanyl-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzamide (PubChem CID 122328012) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 4-methylsulfanyl-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzamide.
| Compound Name | 4-methylsulfanyl-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122328012 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 4-methylsulfanyl-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzamide |
| SMILES | CSc1ccc(C(=O)NCCNc2cc(N3CCOCC3)ncn2)cc1 |
| InChI | InChI=1S/C18H23N5O2S/c1-26-15-4-2-14(3-5-15)18(24)20-7-6-19-16-12-17(22-13-21-16)23-8-10-25-11-9-23/h2-5,12-13H,6-11H2,1H3,(H,20,24)(H,19,21,22) |
| InChIKey | FUSSBWNZSKTFAC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|