C22H28N6O5 — CID 135401554
(3E)-3-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-1-benzofuran-6-ol (PubChem CID 135401554) has the molecular formula C22H28N6O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is (3E)-3-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-1-benzofuran-6-ol.
| Compound Name | (3E)-3-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 135401554 |
| Molecular Formula | C22H28N6O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | (3E)-3-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-1-benzofuran-6-ol |
| SMILES | Oc1ccc2c(c1)OC/C2=N/Nc1cc(N2CCOCC2)nc(OCCN2CCOCC2)n1 |
| InChI | InChI=1S/C22H28N6O5/c29-16-1-2-17-18(15-33-19(17)13-16)25-26-20-14-21(28-6-10-31-11-7-28)24-22(23-20)32-12-5-27-3-8-30-9-4-27/h1-2,13-14,29H,3-12,15H2,(H,23,24,26)/b25-18- |
| InChIKey | XRUXCTNNKVLFKS-BWAHOGKJSA-N |
| XLogP | 0.94 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|