C27H41FN6O2 — CID 143333478
ethane;6-N-[(E)-(5-fluoro-2,3-dihydroinden-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine (PubChem CID 143333478) has the molecular formula C27H41FN6O2 and a molecular weight of 500.66 g/mol. Its IUPAC name is ethane;6-N-[(E)-(5-fluoro-2,3-dihydroinden-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine.
| Compound Name | ethane;6-N-[(E)-(5-fluoro-2,3-dihydroinden-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 143333478 |
| Molecular Formula | C27H41FN6O2 |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | ethane;6-N-[(E)-(5-fluoro-2,3-dihydroinden-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine |
| SMILES | CC.CCCN(CCC)c1cc(N/N=C2\CCc3cc(F)ccc32)nc(OCCN2CCOCC2)n1 |
| InChI | InChI=1S/C25H35FN6O2.C2H6/c1-3-9-32(10-4-2)24-18-23(27-25(28-24)34-16-13-31-11-14-33-15-12-31)30-29-22-8-5-19-17-20(26)6-7-21(19)22;1-2/h6-7,17-18H,3-5,8-16H2,1-2H3,(H,27,28,30);1-2H3/b29-22+; |
| InChIKey | COGJZJOFNOHFJP-KKNNLOHISA-N |
| XLogP | 4.74 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|