C29H46N6O3 — CID 143333391
ethane;6-N-[(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine (PubChem CID 143333391) has the molecular formula C29H46N6O3 and a molecular weight of 526.73 g/mol. Its IUPAC name is ethane;6-N-[(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine.
| Compound Name | ethane;6-N-[(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 143333391 |
| Molecular Formula | C29H46N6O3 |
| Molecular Weight | 526.73 g/mol |
| Exact Mass | 526.36 |
| IUPAC Name | ethane;6-N-[(E)-(7-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine |
| SMILES | CC.CCCN(CCC)c1cc(N/N=C2\CCCc3ccc(OC)cc32)nc(OCCN2CCOCC2)n1 |
| InChI | InChI=1S/C27H40N6O3.C2H6/c1-4-11-33(12-5-2)26-20-25(28-27(29-26)36-18-15-32-13-16-35-17-14-32)31-30-24-8-6-7-21-9-10-22(34-3)19-23(21)24;1-2/h9-10,19-20H,4-8,11-18H2,1-3H3,(H,28,29,31);1-2H3/b30-24+; |
| InChIKey | KFGAJQPNCFROMU-WTKGSRSZSA-N |
| XLogP | 5.00 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.73 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|