C27H40N6O2 — CID 143341512
(5E)-5-[[6-(dipropylamino)-2-(2-piperidin-1-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-7,8-dihydro-6H-naphthalen-2-ol (PubChem CID 143341512) has the molecular formula C27H40N6O2 and a molecular weight of 480.66 g/mol. Its IUPAC name is (5E)-5-[[6-(dipropylamino)-2-(2-piperidin-1-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-7,8-dihydro-6H-naphthalen-2-ol.
| Compound Name | (5E)-5-[[6-(dipropylamino)-2-(2-piperidin-1-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-7,8-dihydro-6H-naphthalen-2-ol |
|---|---|
| PubChem CID | 143341512 |
| Molecular Formula | C27H40N6O2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | (5E)-5-[[6-(dipropylamino)-2-(2-piperidin-1-ylethoxy)pyrimidin-4-yl]hydrazinylidene]-7,8-dihydro-6H-naphthalen-2-ol |
| SMILES | CCCN(CCC)c1cc(N/N=C2\CCCc3cc(O)ccc32)nc(OCCN2CCCCC2)n1 |
| InChI | InChI=1S/C27H40N6O2/c1-3-13-33(14-4-2)26-20-25(28-27(29-26)35-18-17-32-15-6-5-7-16-32)31-30-24-10-8-9-21-19-22(34)11-12-23(21)24/h11-12,19-20,34H,3-10,13-18H2,1-2H3,(H,28,29,31)/b30-24+ |
| InChIKey | QCJWWKZJELZDAJ-BGABXYSRSA-N |
| XLogP | 4.83 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|