C24H31N5O4 — CID 58234827
1-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]methylimino]-2,3-dihydroinden-4-ol (PubChem CID 58234827) has the molecular formula C24H31N5O4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 1-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]methylimino]-2,3-dihydroinden-4-ol.
| Compound Name | 1-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]methylimino]-2,3-dihydroinden-4-ol |
|---|---|
| PubChem CID | 58234827 |
| Molecular Formula | C24H31N5O4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 1-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]methylimino]-2,3-dihydroinden-4-ol |
| SMILES | Oc1cccc2c1CC/C2=N\Cc1cc(N2CCOCC2)nc(OCCN2CCOCC2)n1 |
| InChI | InChI=1S/C24H31N5O4/c30-22-3-1-2-19-20(22)4-5-21(19)25-17-18-16-23(29-9-13-32-14-10-29)27-24(26-18)33-15-8-28-6-11-31-12-7-28/h1-3,16,30H,4-15,17H2/b25-21+ |
| InChIKey | WBWVZICJNWBQEU-NJNXFGOHSA-N |
| XLogP | 1.67 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|