C25H31N5O4 — CID 58531811
5-methyl-3-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]methylimino]-1H-inden-2-one (PubChem CID 58531811) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is 5-methyl-3-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]methylimino]-1H-inden-2-one.
| Compound Name | 5-methyl-3-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]methylimino]-1H-inden-2-one |
|---|---|
| PubChem CID | 58531811 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 5-methyl-3-[[6-morpholin-4-yl-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]methylimino]-1H-inden-2-one |
| SMILES | Cc1ccc2c(c1)/C(=N/Cc1cc(N3CCOCC3)nc(OCCN3CCOCC3)n1)C(=O)C2 |
| InChI | InChI=1S/C25H31N5O4/c1-18-2-3-19-15-22(31)24(21(19)14-18)26-17-20-16-23(30-7-11-33-12-8-30)28-25(27-20)34-13-6-29-4-9-32-10-5-29/h2-3,14,16H,4-13,15,17H2,1H3/b26-24- |
| InChIKey | QYOFEVKBZPNVLM-LCUIJRPUSA-N |
| XLogP | 1.45 |
| TPSA | 89.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|