C24H34N6O2 — CID 91029551
(3,4-dimethylphenyl)-[[6-morpholin-4-yl-2-(2-piperidin-1-ylethoxy)pyrimidin-4-yl]methyl]diazene (PubChem CID 91029551) has the molecular formula C24H34N6O2 and a molecular weight of 438.58 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-[[6-morpholin-4-yl-2-(2-piperidin-1-ylethoxy)pyrimidin-4-yl]methyl]diazene.
| Compound Name | (3,4-dimethylphenyl)-[[6-morpholin-4-yl-2-(2-piperidin-1-ylethoxy)pyrimidin-4-yl]methyl]diazene |
|---|---|
| PubChem CID | 91029551 |
| Molecular Formula | C24H34N6O2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | (3,4-dimethylphenyl)-[[6-morpholin-4-yl-2-(2-piperidin-1-ylethoxy)pyrimidin-4-yl]methyl]diazene |
| SMILES | Cc1ccc(/N=N/Cc2cc(N3CCOCC3)nc(OCCN3CCCCC3)n2)cc1C |
| InChI | InChI=1S/C24H34N6O2/c1-19-6-7-21(16-20(19)2)28-25-18-22-17-23(30-11-13-31-14-12-30)27-24(26-22)32-15-10-29-8-4-3-5-9-29/h6-7,16-17H,3-5,8-15,18H2,1-2H3/b28-25+ |
| InChIKey | WMBKPVLVZIWYGA-AZPGRJICSA-N |
| XLogP | 4.08 |
| TPSA | 75.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|