C22H31N5O4 — CID 91613854
(4,5-dimethylfuran-2-yl)-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]methyl]diazene (PubChem CID 91613854) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is (4,5-dimethylfuran-2-yl)-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]methyl]diazene.
| Compound Name | (4,5-dimethylfuran-2-yl)-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]methyl]diazene |
|---|---|
| PubChem CID | 91613854 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | (4,5-dimethylfuran-2-yl)-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]methyl]diazene |
| SMILES | Cc1cc(/N=N/Cc2cc(N3CCOCC3)cc(OCCN3CCOCC3)n2)oc1C |
| InChI | InChI=1S/C22H31N5O4/c1-17-13-22(31-18(17)2)25-23-16-19-14-20(27-6-10-29-11-7-27)15-21(24-19)30-12-5-26-3-8-28-9-4-26/h13-15H,3-12,16H2,1-2H3/b25-23+ |
| InChIKey | PLKSVKAVZBQHPI-WJTDDFOZSA-N |
| XLogP | 3.12 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|