C24H33N5O3 — CID 90855310
(3,4-dimethylphenyl)methyl-[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazene (PubChem CID 90855310) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is (3,4-dimethylphenyl)methyl-[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazene.
| Compound Name | (3,4-dimethylphenyl)methyl-[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazene |
|---|---|
| PubChem CID | 90855310 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | (3,4-dimethylphenyl)methyl-[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazene |
| SMILES | Cc1ccc(C/N=N/c2cc(N3CCOCC3)cc(OCCN3CCOCC3)n2)cc1C |
| InChI | InChI=1S/C24H33N5O3/c1-19-3-4-21(15-20(19)2)18-25-27-23-16-22(29-8-12-31-13-9-29)17-24(26-23)32-14-7-28-5-10-30-11-6-28/h3-4,15-17H,5-14,18H2,1-2H3/b27-25+ |
| InChIKey | PVLOZURZPPHRPZ-IMVLJIQESA-N |
| XLogP | 3.53 |
| TPSA | 71.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|