C23H26N6O2 — CID 91221280
(3-methylphenyl)methyl-[4-morpholin-4-yl-6-(2-pyrazin-2-ylethoxy)-2-pyridinyl]diazene (PubChem CID 91221280) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is (3-methylphenyl)methyl-[4-morpholin-4-yl-6-(2-pyrazin-2-ylethoxy)-2-pyridinyl]diazene.
| Compound Name | (3-methylphenyl)methyl-[4-morpholin-4-yl-6-(2-pyrazin-2-ylethoxy)-2-pyridinyl]diazene |
|---|---|
| PubChem CID | 91221280 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | (3-methylphenyl)methyl-[4-morpholin-4-yl-6-(2-pyrazin-2-ylethoxy)-2-pyridinyl]diazene |
| SMILES | Cc1cccc(C/N=N/c2cc(N3CCOCC3)cc(OCCc3cnccn3)n2)c1 |
| InChI | InChI=1S/C23H26N6O2/c1-18-3-2-4-19(13-18)16-26-28-22-14-21(29-8-11-30-12-9-29)15-23(27-22)31-10-5-20-17-24-6-7-25-20/h2-4,6-7,13-15,17H,5,8-12,16H2,1H3/b28-26+ |
| InChIKey | FSLCPMNJGWCRBP-BYCLXTJYSA-N |
| XLogP | 3.92 |
| TPSA | 85.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|