C27H29N5O2 — CID 91022452
[6-[2-(1H-indol-3-yl)ethoxy]-4-morpholin-4-yl-2-pyridinyl]-[(3-methylphenyl)methyl]diazene (PubChem CID 91022452) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is [6-[2-(1H-indol-3-yl)ethoxy]-4-morpholin-4-yl-2-pyridinyl]-[(3-methylphenyl)methyl]diazene.
| Compound Name | [6-[2-(1H-indol-3-yl)ethoxy]-4-morpholin-4-yl-2-pyridinyl]-[(3-methylphenyl)methyl]diazene |
|---|---|
| PubChem CID | 91022452 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | [6-[2-(1H-indol-3-yl)ethoxy]-4-morpholin-4-yl-2-pyridinyl]-[(3-methylphenyl)methyl]diazene |
| SMILES | Cc1cccc(C/N=N/c2cc(N3CCOCC3)cc(OCCc3c[nH]c4ccccc34)n2)c1 |
| InChI | InChI=1S/C27H29N5O2/c1-20-5-4-6-21(15-20)18-29-31-26-16-23(32-10-13-33-14-11-32)17-27(30-26)34-12-9-22-19-28-25-8-3-2-7-24(22)25/h2-8,15-17,19,28H,9-14,18H2,1H3/b31-29+ |
| InChIKey | SJVQZKHGPYTFFM-OWWNRXNESA-N |
| XLogP | 5.61 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|