C25H23N7O — CID 123719867
1H-indol-3-ylmethyl-(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)diazene (PubChem CID 123719867) has the molecular formula C25H23N7O and a molecular weight of 437.51 g/mol. Its IUPAC name is 1H-indol-3-ylmethyl-(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)diazene.
| Compound Name | 1H-indol-3-ylmethyl-(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)diazene |
|---|---|
| PubChem CID | 123719867 |
| Molecular Formula | C25H23N7O |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 1H-indol-3-ylmethyl-(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)diazene |
| SMILES | c1ccc(-c2cc3nc(/N=N/Cc4c[nH]c5ccccc45)cc(N4CCOCC4)n3n2)cc1 |
| InChI | InChI=1S/C25H23N7O/c1-2-6-18(7-3-1)22-14-24-28-23(15-25(32(24)30-22)31-10-12-33-13-11-31)29-27-17-19-16-26-21-9-5-4-8-20(19)21/h1-9,14-16,26H,10-13,17H2/b29-27+ |
| InChIKey | CXDOSOQGWCHIFT-ORIPQNMZSA-N |
| XLogP | 5.00 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|