C24H21N7OS — CID 123640264
1-benzothiophen-2-ylmethyl-(7-morpholin-4-yl-2-pyridin-4-ylpyrazolo[1,5-a]pyrimidin-5-yl)diazene (PubChem CID 123640264) has the molecular formula C24H21N7OS and a molecular weight of 455.55 g/mol. Its IUPAC name is 1-benzothiophen-2-ylmethyl-(7-morpholin-4-yl-2-pyridin-4-ylpyrazolo[1,5-a]pyrimidin-5-yl)diazene.
| Compound Name | 1-benzothiophen-2-ylmethyl-(7-morpholin-4-yl-2-pyridin-4-ylpyrazolo[1,5-a]pyrimidin-5-yl)diazene |
|---|---|
| PubChem CID | 123640264 |
| Molecular Formula | C24H21N7OS |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 1-benzothiophen-2-ylmethyl-(7-morpholin-4-yl-2-pyridin-4-ylpyrazolo[1,5-a]pyrimidin-5-yl)diazene |
| SMILES | c1ccc2sc(C/N=N/c3cc(N4CCOCC4)n4nc(-c5ccncc5)cc4n3)cc2c1 |
| InChI | InChI=1S/C24H21N7OS/c1-2-4-21-18(3-1)13-19(33-21)16-26-28-22-15-24(30-9-11-32-12-10-30)31-23(27-22)14-20(29-31)17-5-7-25-8-6-17/h1-8,13-15H,9-12,16H2/b28-26+ |
| InChIKey | KKFRZCZPGTYUFY-BYCLXTJYSA-N |
| XLogP | 5.13 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|