C25H25N5O — CID 58531005
1-(2-methylphenyl)-N-[(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)methyl]methanimine (PubChem CID 58531005) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-(2-methylphenyl)-N-[(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)methyl]methanimine.
| Compound Name | 1-(2-methylphenyl)-N-[(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)methyl]methanimine |
|---|---|
| PubChem CID | 58531005 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 1-(2-methylphenyl)-N-[(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)methyl]methanimine |
| SMILES | Cc1ccccc1/C=N/Cc1cc(N2CCOCC2)n2nc(-c3ccccc3)cc2n1 |
| InChI | InChI=1S/C25H25N5O/c1-19-7-5-6-10-21(19)17-26-18-22-15-25(29-11-13-31-14-12-29)30-24(27-22)16-23(28-30)20-8-3-2-4-9-20/h2-10,15-17H,11-14,18H2,1H3/b26-17+ |
| InChIKey | RRMWQGPWXXPIMU-YZSQISJMSA-N |
| XLogP | 4.16 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|