C22H22N6O2 — CID 123271449
(5-methylfuran-2-yl)methyl-(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)diazene (PubChem CID 123271449) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is (5-methylfuran-2-yl)methyl-(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)diazene.
| Compound Name | (5-methylfuran-2-yl)methyl-(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)diazene |
|---|---|
| PubChem CID | 123271449 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (5-methylfuran-2-yl)methyl-(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)diazene |
| SMILES | Cc1ccc(C/N=N/c2cc(N3CCOCC3)n3nc(-c4ccccc4)cc3n2)o1 |
| InChI | InChI=1S/C22H22N6O2/c1-16-7-8-18(30-16)15-23-25-20-14-22(27-9-11-29-12-10-27)28-21(24-20)13-19(26-28)17-5-3-2-4-6-17/h2-8,13-14H,9-12,15H2,1H3/b25-23+ |
| InChIKey | YJEHKNKDSTZRQX-WJTDDFOZSA-N |
| XLogP | 4.42 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|