C25H26N6O — CID 70999540
7-morpholin-4-yl-2-phenyl-N-[(E)-3-phenylpropylideneamino]pyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 70999540) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is 7-morpholin-4-yl-2-phenyl-N-[(E)-3-phenylpropylideneamino]pyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | 7-morpholin-4-yl-2-phenyl-N-[(E)-3-phenylpropylideneamino]pyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 70999540 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 7-morpholin-4-yl-2-phenyl-N-[(E)-3-phenylpropylideneamino]pyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | C(\CCc1ccccc1)=N/Nc1cc(N2CCOCC2)n2nc(-c3ccccc3)cc2n1 |
| InChI | InChI=1S/C25H26N6O/c1-3-8-20(9-4-1)10-7-13-26-28-23-19-25(30-14-16-32-17-15-30)31-24(27-23)18-22(29-31)21-11-5-2-6-12-21/h1-6,8-9,11-13,18-19H,7,10,14-17H2,(H,27,28)/b26-13+ |
| InChIKey | AECZDRVNBJIDJH-LGJNPRDNSA-N |
| XLogP | 4.26 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|