C26H25N7O — CID 172983490
N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 172983490) has the molecular formula C26H25N7O and a molecular weight of 451.53 g/mol. Its IUPAC name is N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 172983490 |
| Molecular Formula | C26H25N7O |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | Cc1[nH]c2ccccc2c1/C=N/Nc1cc(N2CCOCC2)n2nc(-c3ccccc3)cc2n1 |
| InChI | InChI=1S/C26H25N7O/c1-18-21(20-9-5-6-10-22(20)28-18)17-27-30-24-16-26(32-11-13-34-14-12-32)33-25(29-24)15-23(31-33)19-7-3-2-4-8-19/h2-10,15-17,28H,11-14H2,1H3,(H,29,30)/b27-17+ |
| InChIKey | HCMFCVFMGTXMNN-WPWMEQJKSA-N |
| XLogP | 4.47 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|