C25H23N7O — CID 89176664
N-[(E)-1H-indol-4-ylmethylideneamino]-7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 89176664) has the molecular formula C25H23N7O and a molecular weight of 437.51 g/mol. Its IUPAC name is N-[(E)-1H-indol-4-ylmethylideneamino]-7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-[(E)-1H-indol-4-ylmethylideneamino]-7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 89176664 |
| Molecular Formula | C25H23N7O |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-[(E)-1H-indol-4-ylmethylideneamino]-7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | C(=N/Nc1cc(N2CCOCC2)n2nc(-c3ccccc3)cc2n1)\c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C25H23N7O/c1-2-5-18(6-3-1)22-15-24-28-23(16-25(32(24)30-22)31-11-13-33-14-12-31)29-27-17-19-7-4-8-21-20(19)9-10-26-21/h1-10,15-17,26H,11-14H2,(H,28,29)/b27-17+ |
| InChIKey | WDNUMHGXUQQOES-WPWMEQJKSA-N |
| XLogP | 4.16 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|