C16H17ClN6O — CID 70867227
[2-(3-chlorophenyl)-7-morpholin-4-ylpyrazolo[1,5-a]pyrimidin-5-yl]hydrazine (PubChem CID 70867227) has the molecular formula C16H17ClN6O and a molecular weight of 344.81 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-7-morpholin-4-ylpyrazolo[1,5-a]pyrimidin-5-yl]hydrazine.
| Compound Name | [2-(3-chlorophenyl)-7-morpholin-4-ylpyrazolo[1,5-a]pyrimidin-5-yl]hydrazine |
|---|---|
| PubChem CID | 70867227 |
| Molecular Formula | C16H17ClN6O |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [2-(3-chlorophenyl)-7-morpholin-4-ylpyrazolo[1,5-a]pyrimidin-5-yl]hydrazine |
| SMILES | NNc1cc(N2CCOCC2)n2nc(-c3cccc(Cl)c3)cc2n1 |
| InChI | InChI=1S/C16H17ClN6O/c17-12-3-1-2-11(8-12)13-9-15-19-14(20-18)10-16(23(15)21-13)22-4-6-24-7-5-22/h1-3,8-10H,4-7,18H2,(H,19,20) |
| InChIKey | YRIOXOLNXVDFNW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|