C14H21N7O2 — CID 70999571
(2,7-dimorpholin-4-ylpyrazolo[1,5-a]pyrimidin-5-yl)hydrazine (PubChem CID 70999571) has the molecular formula C14H21N7O2 and a molecular weight of 319.37 g/mol. Its IUPAC name is (2,7-dimorpholin-4-ylpyrazolo[1,5-a]pyrimidin-5-yl)hydrazine.
| Compound Name | (2,7-dimorpholin-4-ylpyrazolo[1,5-a]pyrimidin-5-yl)hydrazine |
|---|---|
| PubChem CID | 70999571 |
| Molecular Formula | C14H21N7O2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (2,7-dimorpholin-4-ylpyrazolo[1,5-a]pyrimidin-5-yl)hydrazine |
| SMILES | NNc1cc(N2CCOCC2)n2nc(N3CCOCC3)cc2n1 |
| InChI | InChI=1S/C14H21N7O2/c15-17-11-9-14(20-3-7-23-8-4-20)21-12(16-11)10-13(18-21)19-1-5-22-6-2-19/h9-10H,1-8,15H2,(H,16,17) |
| InChIKey | RMCQWNLXOYROPC-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|