C9H12N6O — CID 15107884
6-morpholin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-amine (PubChem CID 15107884) has the molecular formula C9H12N6O and a molecular weight of 220.24 g/mol. Its IUPAC name is 6-morpholin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-amine.
| Compound Name | 6-morpholin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-amine |
|---|---|
| PubChem CID | 15107884 |
| Molecular Formula | C9H12N6O |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 6-morpholin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-amine |
| SMILES | Nc1nnc2ccc(N3CCOCC3)nn12 |
| InChI | InChI=1S/C9H12N6O/c10-9-12-11-7-1-2-8(13-15(7)9)14-3-5-16-6-4-14/h1-2H,3-6H2,(H2,10,12) |
| InChIKey | KZUQXBIEKNRHRM-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |