C16H23N7O3S — CID 154581408
4-[[2-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]morpholine (PubChem CID 154581408) has the molecular formula C16H23N7O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 4-[[2-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]morpholine.
| Compound Name | 4-[[2-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]morpholine |
|---|---|
| PubChem CID | 154581408 |
| Molecular Formula | C16H23N7O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 4-[[2-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]morpholine |
| SMILES | Cc1nnc2ccc(N3CC4CN(S(=O)(=O)N5CCOCC5)CC4C3)nn12 |
| InChI | InChI=1S/C16H23N7O3S/c1-12-17-18-15-2-3-16(19-23(12)15)20-8-13-10-22(11-14(13)9-20)27(24,25)21-4-6-26-7-5-21/h2-3,13-14H,4-11H2,1H3 |
| InChIKey | SDJWFMCHDWPSLB-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 96.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |