C20H22N6O3S — CID 154854172
(2-methylsulfonylphenyl)-[2-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 154854172) has the molecular formula C20H22N6O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is (2-methylsulfonylphenyl)-[2-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | (2-methylsulfonylphenyl)-[2-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 154854172 |
| Molecular Formula | C20H22N6O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (2-methylsulfonylphenyl)-[2-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | Cc1nnc2ccc(N3CC4CN(C(=O)c5ccccc5S(C)(=O)=O)CC4C3)nn12 |
| InChI | InChI=1S/C20H22N6O3S/c1-13-21-22-18-7-8-19(23-26(13)18)24-9-14-11-25(12-15(14)10-24)20(27)16-5-3-4-6-17(16)30(2,28)29/h3-8,14-15H,9-12H2,1-2H3 |
| InChIKey | NNMREXKXXRVORG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 100.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |