C20H21BrN6O — CID 154883789
2-(2-bromophenyl)-1-[2-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone (PubChem CID 154883789) has the molecular formula C20H21BrN6O and a molecular weight of 441.33 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1-[2-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone.
| Compound Name | 2-(2-bromophenyl)-1-[2-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone |
|---|---|
| PubChem CID | 154883789 |
| Molecular Formula | C20H21BrN6O |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 2-(2-bromophenyl)-1-[2-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone |
| SMILES | Cc1nnc2ccc(N3CC4CN(C(=O)Cc5ccccc5Br)CC4C3)nn12 |
| InChI | InChI=1S/C20H21BrN6O/c1-13-22-23-18-6-7-19(24-27(13)18)25-9-15-11-26(12-16(15)10-25)20(28)8-14-4-2-3-5-17(14)21/h2-7,15-16H,8-12H2,1H3 |
| InChIKey | JLKUCGVQVWSDEF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |