C21H23FN6O — CID 155981769
1-[2-(3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(4-fluorophenyl)ethanone (PubChem CID 155981769) has the molecular formula C21H23FN6O and a molecular weight of 394.45 g/mol. Its IUPAC name is 1-[2-(3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[2-(3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 155981769 |
| Molecular Formula | C21H23FN6O |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-[2-(3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(4-fluorophenyl)ethanone |
| SMILES | CCc1nnc2ccc(N3CC4CN(C(=O)Cc5ccc(F)cc5)CC4C3)nn12 |
| InChI | InChI=1S/C21H23FN6O/c1-2-18-23-24-19-7-8-20(25-28(18)19)26-10-15-12-27(13-16(15)11-26)21(29)9-14-3-5-17(22)6-4-14/h3-8,15-16H,2,9-13H2,1H3 |
| InChIKey | XFSSGPFMXWXNBQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |