C18H22N8O — CID 155981732
[2-(3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-methylpyrazol-4-yl)methanone (PubChem CID 155981732) has the molecular formula C18H22N8O and a molecular weight of 366.43 g/mol. Its IUPAC name is [2-(3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-methylpyrazol-4-yl)methanone.
| Compound Name | [2-(3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-methylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 155981732 |
| Molecular Formula | C18H22N8O |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [2-(3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-methylpyrazol-4-yl)methanone |
| SMILES | CCc1nnc2ccc(N3CC4CN(C(=O)c5cnn(C)c5)CC4C3)nn12 |
| InChI | InChI=1S/C18H22N8O/c1-3-15-20-21-16-4-5-17(22-26(15)16)24-8-13-10-25(11-14(13)9-24)18(27)12-6-19-23(2)7-12/h4-7,13-14H,3,8-11H2,1-2H3 |
| InChIKey | NOVILQCOENZQQX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 84.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |