C19H23FN8 — CID 155980643
3-ethyl-6-[5-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 155980643) has the molecular formula C19H23FN8 and a molecular weight of 382.45 g/mol. Its IUPAC name is 3-ethyl-6-[5-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-ethyl-6-[5-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 155980643 |
| Molecular Formula | C19H23FN8 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 3-ethyl-6-[5-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | CCc1ncnc(N2CC3CN(c4ccc5nnc(CC)n5n4)CC3C2)c1F |
| InChI | InChI=1S/C19H23FN8/c1-3-14-18(20)19(22-11-21-14)27-9-12-7-26(8-13(12)10-27)17-6-5-16-24-23-15(4-2)28(16)25-17/h5-6,11-13H,3-4,7-10H2,1-2H3 |
| InChIKey | NZXBZCOPKMUJSY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |