C14H20FN3O — CID 139014297
(3aS,5S,7aR)-2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 139014297) has the molecular formula C14H20FN3O and a molecular weight of 265.33 g/mol. Its IUPAC name is (3aS,5S,7aR)-2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aS,5S,7aR)-2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 139014297 |
| Molecular Formula | C14H20FN3O |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | (3aS,5S,7aR)-2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | CCc1ncnc(N2C[C@H]3C[C@@H](O)CC[C@H]3C2)c1F |
| InChI | InChI=1S/C14H20FN3O/c1-2-12-13(15)14(17-8-16-12)18-6-9-3-4-11(19)5-10(9)7-18/h8-11,19H,2-7H2,1H3/t9-,10+,11-/m0/s1 |
| InChIKey | OVIKDVOHRYNFHZ-AXFHLTTASA-N |
| XLogP | 1.78 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |