C17H22FN5O — CID 155941681
4-[[5-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2-methyl-1,3-oxazole (PubChem CID 155941681) has the molecular formula C17H22FN5O and a molecular weight of 331.40 g/mol. Its IUPAC name is 4-[[5-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2-methyl-1,3-oxazole.
| Compound Name | 4-[[5-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 155941681 |
| Molecular Formula | C17H22FN5O |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 4-[[5-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2-methyl-1,3-oxazole |
| SMILES | CCc1ncnc(N2CC3CN(Cc4coc(C)n4)CC3C2)c1F |
| InChI | InChI=1S/C17H22FN5O/c1-3-15-16(18)17(20-10-19-15)23-6-12-4-22(5-13(12)7-23)8-14-9-24-11(2)21-14/h9-10,12-13H,3-8H2,1-2H3 |
| InChIKey | KKTFMQFPADXZHQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |