C22H26N6O3 — CID 155981791
(3,4-dimethoxyphenyl)-[2-(3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 155981791) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[2-(3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | (3,4-dimethoxyphenyl)-[2-(3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 155981791 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[2-(3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | CCc1nnc2ccc(N3CC4CN(C(=O)c5ccc(OC)c(OC)c5)CC4C3)nn12 |
| InChI | InChI=1S/C22H26N6O3/c1-4-19-23-24-20-7-8-21(25-28(19)20)26-10-15-12-27(13-16(15)11-26)22(29)14-5-6-17(30-2)18(9-14)31-3/h5-9,15-16H,4,10-13H2,1-3H3 |
| InChIKey | HFGYDUJDDLDUFR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 85.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |