C22H22N8O — CID 173486980
N-[(E)-(3-methylphenyl)methylideneamino]-7-morpholin-4-yl-2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 173486980) has the molecular formula C22H22N8O and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[(E)-(3-methylphenyl)methylideneamino]-7-morpholin-4-yl-2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-[(E)-(3-methylphenyl)methylideneamino]-7-morpholin-4-yl-2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 173486980 |
| Molecular Formula | C22H22N8O |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-[(E)-(3-methylphenyl)methylideneamino]-7-morpholin-4-yl-2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | Cc1cccc(/C=N/Nc2cc(N3CCOCC3)n3nc(-c4cnccn4)cc3n2)c1 |
| InChI | InChI=1S/C22H22N8O/c1-16-3-2-4-17(11-16)14-25-27-20-13-22(29-7-9-31-10-8-29)30-21(26-20)12-18(28-30)19-15-23-5-6-24-19/h2-6,11-15H,7-10H2,1H3,(H,26,27)/b25-14+ |
| InChIKey | GCRRTQBDJVVTGH-AFUMVMLFSA-N |
| XLogP | 2.78 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|