C24H24N6O — CID 171463185
N-[(E)-(3-methylphenyl)methylideneamino]-7-morpholin-4-yl-2-pyridin-4-ylpyrazolo[1,5-a]pyridin-5-amine (PubChem CID 171463185) has the molecular formula C24H24N6O and a molecular weight of 412.50 g/mol. Its IUPAC name is N-[(E)-(3-methylphenyl)methylideneamino]-7-morpholin-4-yl-2-pyridin-4-ylpyrazolo[1,5-a]pyridin-5-amine.
| Compound Name | N-[(E)-(3-methylphenyl)methylideneamino]-7-morpholin-4-yl-2-pyridin-4-ylpyrazolo[1,5-a]pyridin-5-amine |
|---|---|
| PubChem CID | 171463185 |
| Molecular Formula | C24H24N6O |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-[(E)-(3-methylphenyl)methylideneamino]-7-morpholin-4-yl-2-pyridin-4-ylpyrazolo[1,5-a]pyridin-5-amine |
| SMILES | Cc1cccc(/C=N/Nc2cc(N3CCOCC3)n3nc(-c4ccncc4)cc3c2)c1 |
| InChI | InChI=1S/C24H24N6O/c1-18-3-2-4-19(13-18)17-26-27-21-14-22-16-23(20-5-7-25-8-6-20)28-30(22)24(15-21)29-9-11-31-12-10-29/h2-8,13-17,27H,9-12H2,1H3/b26-17+ |
| InChIKey | DFMINMIBWOQJDN-YZSQISJMSA-N |
| XLogP | 3.99 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|