C22H24N8O — CID 142437689
(3-methylphenyl)methanimine;7-morpholin-4-yl-2-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine (PubChem CID 142437689) has the molecular formula C22H24N8O and a molecular weight of 416.49 g/mol. Its IUPAC name is (3-methylphenyl)methanimine;7-morpholin-4-yl-2-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | (3-methylphenyl)methanimine;7-morpholin-4-yl-2-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 142437689 |
| Molecular Formula | C22H24N8O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (3-methylphenyl)methanimine;7-morpholin-4-yl-2-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine |
| SMILES | Nc1cc(N2CCOCC2)n2nc(-c3ccncc3)nc2n1.[H]/N=C/c1cccc(C)c1 |
| InChI | InChI=1S/C14H15N7O.C8H9N/c15-11-9-12(20-5-7-22-8-6-20)21-14(17-11)18-13(19-21)10-1-3-16-4-2-10;1-7-3-2-4-8(5-7)6-9/h1-4,9H,5-8H2,(H2,15,17,18,19);2-6,9H,1H3/b;9-6+ |
| InChIKey | ORERNSTZAPIQJG-RRJFPGPQSA-N |
| XLogP | 2.60 |
| TPSA | 118.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|