C23H30N6O2 — CID 145170671
2-[2-(3,4-dihydropyridin-6-yl)ethoxy]-6-morpholin-4-ylpyrimidin-4-amine;(3-methylphenyl)methanimine (PubChem CID 145170671) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[2-(3,4-dihydropyridin-6-yl)ethoxy]-6-morpholin-4-ylpyrimidin-4-amine;(3-methylphenyl)methanimine.
| Compound Name | 2-[2-(3,4-dihydropyridin-6-yl)ethoxy]-6-morpholin-4-ylpyrimidin-4-amine;(3-methylphenyl)methanimine |
|---|---|
| PubChem CID | 145170671 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-[2-(3,4-dihydropyridin-6-yl)ethoxy]-6-morpholin-4-ylpyrimidin-4-amine;(3-methylphenyl)methanimine |
| SMILES | Nc1cc(N2CCOCC2)nc(OCCC2=CCCC=N2)n1.[H]/N=C/c1cccc(C)c1 |
| InChI | InChI=1S/C15H21N5O2.C8H9N/c16-13-11-14(20-6-9-21-10-7-20)19-15(18-13)22-8-4-12-3-1-2-5-17-12;1-7-3-2-4-8(5-7)6-9/h3,5,11H,1-2,4,6-10H2,(H2,16,18,19);2-6,9H,1H3/b;9-6+ |
| InChIKey | XZDRNDQIRDYLFF-RRJFPGPQSA-N |
| XLogP | 3.41 |
| TPSA | 109.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|