C22H27N7O — CID 142437698
N'-(4-amino-6-morpholin-4-ylpyrimidin-2-yl)benzenecarboximidamide;molecular hydrogen;phenylmethanimine (PubChem CID 142437698) has the molecular formula C22H27N7O and a molecular weight of 405.51 g/mol. Its IUPAC name is N'-(4-amino-6-morpholin-4-ylpyrimidin-2-yl)benzenecarboximidamide;molecular hydrogen;phenylmethanimine.
| Compound Name | N'-(4-amino-6-morpholin-4-ylpyrimidin-2-yl)benzenecarboximidamide;molecular hydrogen;phenylmethanimine |
|---|---|
| PubChem CID | 142437698 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | N'-(4-amino-6-morpholin-4-ylpyrimidin-2-yl)benzenecarboximidamide;molecular hydrogen;phenylmethanimine |
| SMILES | N/C(=N\c1nc(N)cc(N2CCOCC2)n1)c1ccccc1.[H]/N=C/c1ccccc1.[H][H] |
| InChI | InChI=1S/C15H18N6O.C7H7N.H2/c16-12-10-13(21-6-8-22-9-7-21)19-15(18-12)20-14(17)11-4-2-1-3-5-11;8-6-7-4-2-1-3-5-7;/h1-5,10H,6-9H2,(H4,16,17,18,19,20);1-6,8H;1H/b;8-6+; |
| InChIKey | IUCHXTBDNNOABR-MMVXAHOZSA-N |
| XLogP | 2.86 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|