C16H15N3S — CID 167447331
(Z)-N'-(3-methanimidoylphenyl)-3-phenyl-3-sulfanylprop-2-enimidamide (PubChem CID 167447331) has the molecular formula C16H15N3S and a molecular weight of 281.38 g/mol. Its IUPAC name is (Z)-N'-(3-methanimidoylphenyl)-3-phenyl-3-sulfanylprop-2-enimidamide.
| Compound Name | (Z)-N'-(3-methanimidoylphenyl)-3-phenyl-3-sulfanylprop-2-enimidamide |
|---|---|
| PubChem CID | 167447331 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (Z)-N'-(3-methanimidoylphenyl)-3-phenyl-3-sulfanylprop-2-enimidamide |
| SMILES | [H]/N=C/c1cccc(/N=C(N)/C=C(\S)c2ccccc2)c1 |
| InChI | InChI=1S/C16H15N3S/c17-11-12-5-4-8-14(9-12)19-16(18)10-15(20)13-6-2-1-3-7-13/h1-11,17,20H,(H2,18,19)/b15-10-,17-11+ |
| InChIKey | DMNJLUIDGPAMJZ-JBOZTJCHSA-N |
| XLogP | 3.64 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|