About (4-methoxyphenyl)methanimine;phenylmethanimine
(4-methoxyphenyl)methanimine;phenylmethanimine (PubChem CID 157101664) has the molecular formula C15H16N2O
and a molecular weight of 240.31 g/mol. Its IUPAC name is (4-methoxyphenyl)methanimine;phenylmethanimine.
Molecular Properties
| Compound Name | (4-methoxyphenyl)methanimine;phenylmethanimine |
| PubChem CID | 157101664 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (4-methoxyphenyl)methanimine;phenylmethanimine |
| SMILES | [H]/N=C/c1ccc(OC)cc1.[H]/N=C/c1ccccc1 |
| InChI | InChI=1S/C8H9NO.C7H7N/c1-10-8-4-2-7(6-9)3-5-8;8-6-7-4-2-1-3-5-7/h2-6,9H,1H3;1-6,8H/b9-6+;8-6+ |
| InChIKey | AFVGFVDWQGGRDM-ASNXFWNDSA-N |
| XLogP | 3.38 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl)methanimine;phenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)methanimine;phenylmethanimine?
The IUPAC name of (4-methoxyphenyl)methanimine;phenylmethanimine (CID 157101664) is (4-methoxyphenyl)methanimine;phenylmethanimine.
What is the SMILES notation for (4-methoxyphenyl)methanimine;phenylmethanimine?
The canonical SMILES for (4-methoxyphenyl)methanimine;phenylmethanimine is [H]/N=C/c1ccc(OC)cc1.[H]/N=C/c1ccccc1.
What is the InChIKey of (4-methoxyphenyl)methanimine;phenylmethanimine?
The InChIKey is AFVGFVDWQGGRDM-ASNXFWNDSA-N. The full InChI is InChI=1S/C8H9NO.C7H7N/c1-10-8-4-2-7(6-9)3-5-8;8-6-7-4-2-1-3-5-7/h2-6,9H,1H3;1-6,8H/b9-6+;8-6+.
What are the key properties of (4-methoxyphenyl)methanimine;phenylmethanimine?
(4-methoxyphenyl)methanimine;phenylmethanimine has a molecular weight of 240.31 g/mol, XLogP of 3.38, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)methanimine;phenylmethanimine is sourced from PubChem (CID 157101664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).